(2E)-2-(hydroxymethylidene)-5,6,7-trimethoxy-tetralin-1-one structure
|
Common Name | (2E)-2-(hydroxymethylidene)-5,6,7-trimethoxy-tetralin-1-one | ||
|---|---|---|---|---|
| CAS Number | 57897-17-3 | Molecular Weight | 264.27400 | |
| Density | 1.301g/cm3 | Boiling Point | 458.2ºC at 760 mmHg | |
| Molecular Formula | C14H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | (2E)-2-(hydroxymethylidene)-5,6,7-trimethoxy-3,4-dihydronaphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 458.2ºC at 760 mmHg |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.27400 |
| Flash Point | 174ºC |
| Exact Mass | 264.10000 |
| PSA | 64.99000 |
| LogP | 2.28320 |
| Index of Refraction | 1.616 |
| InChIKey | BEELZDOKCQWLQZ-BQYQJAHWSA-N |
| SMILES | COc1cc2c(c(OC)c1OC)CCC(=CO)C2=O |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (2E)-2-(hydroxymethylidene)-5,6,7-trimethoxy-1,2,3,4-tetrahydronaphthalen-1-one |
| 5,6,7-trimethoxy-1-oxo-1,2,3,4-tetrahydro-naphthalene-2-carbaldehyde |
| 2-hydroxymethylene-5,6,7-trimethoxy-3,4-dihydro-2H-naphthalen-1-one |