1-(4-Nitrophenoxy)-3-(isopropylamino)-2-propanol structure
|
Common Name | 1-(4-Nitrophenoxy)-3-(isopropylamino)-2-propanol | ||
|---|---|---|---|---|
| CAS Number | 5790-18-1 | Molecular Weight | 254.28200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-nitrophenoxy)-3-(propan-2-ylamino)propan-2-ol |
|---|
| Molecular Formula | C12H18N2O4 |
|---|---|
| Molecular Weight | 254.28200 |
| Exact Mass | 254.12700 |
| PSA | 87.31000 |
| LogP | 2.24660 |
| InChIKey | FVTYVCCGZZUEHP-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)COc1ccc([N+](=O)[O-])cc1 |
|
~%
1-(4-Nitropheno... CAS#:5790-18-1 |
| Literature: Connors, Sean P.; Dennis, Paul D.; Gill, Edward W.; Terrar, Derek A. Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1570 - 1577 |
|
~%
1-(4-Nitropheno... CAS#:5790-18-1 |
| Literature: Connors, Sean P.; Dennis, Paul D.; Gill, Edward W.; Terrar, Derek A. Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1570 - 1577 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |