2-(1H-indol-3-yl)-N-(2-methoxyphenyl)acetamide structure
|
Common Name | 2-(1H-indol-3-yl)-N-(2-methoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 57932-45-3 | Molecular Weight | 280.32100 | |
| Density | 1.276g/cm3 | Boiling Point | 538.6ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.5ºC | |
| Name | 2-(1H-indol-3-yl)-N-(2-methoxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 538.6ºC at 760 mmHg |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.32100 |
| Flash Point | 279.5ºC |
| Exact Mass | 280.12100 |
| PSA | 57.61000 |
| LogP | 4.00720 |
| Index of Refraction | 1.69 |
| InChIKey | DYNOXPGMQGXPNJ-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)Cc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
2-(1H-indol-3-y... CAS#:57932-45-3 |
| Literature: Tolkunov; Dulenko Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 4 p. 481 - 489 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| p-ACETANISIDIDE,2-INDOL-3-YL |