WAY-326769 structure
|
Common Name | WAY-326769 | ||
|---|---|---|---|---|
| CAS Number | 871700-29-7 | Molecular Weight | 441.52 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 732.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C27H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 396.5±32.9 °C | |
Use of WAY-326769increasing ion transport by mutant-CFTR; |
| Name | WAY-326769 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 732.0±60.0 °C at 760 mmHg |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.52 |
| Flash Point | 396.5±32.9 °C |
| Exact Mass | 441.205231 |
| LogP | 4.22 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | SHUDPPSLXZZLQS-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)C(c2ccc(C)cc2)N(C)C(=O)Cc2c[nH]c3ccccc23)cc1 |
| 1H-Indole-3-acetamide, N-[2-[(4-methoxyphenyl)amino]-1-(4-methylphenyl)-2-oxoethyl]-N-methyl- |
| 2-(1H-Indol-3-yl)-N-{2-[(4-methoxyphenyl)amino]-1-(4-methylphenyl)-2-oxoethyl}-N-methylacetamide |