thiazinamium metilsulfate
thiazinamium metilsulfate structure
|
Common Name | thiazinamium metilsulfate | ||
|---|---|---|---|---|
| CAS Number | 58-34-4 | Molecular Weight | 410.55100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26N2O4S2 | Melting Point | 206-210° (some dec) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 206-210° (some dec) |
|---|---|
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.55100 |
| Exact Mass | 410.13300 |
| PSA | 103.35000 |
| LogP | 4.62280 |
| InChIKey | BVIDQAVCCRUFGU-UHFFFAOYSA-M |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)[N+](C)(C)C.COS(=O)(=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
thiazinamium me... CAS#:58-34-4 |
| Literature: American Home Products Corporation Patent: US4097596 A1, 1978 ; |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Activity against intracellular amastigotes of Trypanosoma cruzi (macrophage infection...
Source: ChEMBL
Target: N/A
External Id: CHEMBL808715
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| dl-trimethyl[1-methyl-2-(phenothiazin-10-yl)ethyl]ammonium iodide |
| Trimethylammonium-isopropyl-phenthiazin jodid |
| Promethazin methoiodid |
| Methylsulfat |
| Promethazin-Methyliodid |
| Promethazine methiodide |
| Ammonium,(1-(phenothiazin-10-yl)-2-propyl)trimethyl-,iodide |
| Thiazinamium iodide |
| (1-(Phenothiazin-10-yl)-2-propyl)trimethylammonium iodide |
| trimethyl-(1-methyl-2-phenothiazin-10-yl-ethyl)-ammonium,iodide |
| thiazinamium metilsulfate |
| Promethazinum-methoiodide |
| 1-<Pheno-thiazinyl-10'>-Vb |
| Trimethylammonium-isopropyl-phenthiazin jodid [German] |
| dl-trimethyl[1-methyl-2-(phenothiazine-10-yl)ethyl]ammonium methyl sulfate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate? |
| A: SMILES notation of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate is CC(CN1c2ccccc2Sc2ccccc21)[N+](C)(C)C.COS(=O)(=O)[O-]. |
| Q: What is the CAS number of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate? |
| A: CAS number of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate is 58-34-4. |
| Q: What is the melting point of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate? |
| A: Melting point of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate is 206-210° (some dec). |
| Q: What is the English name of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate? |
| A: The English name of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate is N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate. |
| Q: What is the polar surface area (PSA) of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate? |
| A: Polar surface area (PSA) of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate is 103.35000. |
| Q: What is the LogP of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate? |
| A: LogP of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate is 4.62280. |
| Q: What is the molecular formula of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate? |
| A: Molecular formula of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate is C19H26N2O4S2. |
| Q: What is the InChIKey of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate? |
| A: InChIKey of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate is BVIDQAVCCRUFGU-UHFFFAOYSA-M. |
| Q: What is the molecular weight of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate? |
| A: Molecular weight of N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate is 410.55100. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |