thiazinamium metilsulfate
Modify Date: 2025-09-05 23:50:33
thiazinamium metilsulfate structure
|
Common Name | thiazinamium metilsulfate | ||
|---|---|---|---|---|
| CAS Number | 58-34-4 | Molecular Weight | 410.55100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26N2O4S2 | Melting Point | 206-210° (some dec) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)-2-propanaminium methyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 206-210° (some dec) |
|---|---|
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.55100 |
| Exact Mass | 410.13300 |
| PSA | 103.35000 |
| LogP | 4.62280 |
| InChIKey | BVIDQAVCCRUFGU-UHFFFAOYSA-M |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)[N+](C)(C)C.COS(=O)(=O)[O-] |
|
~%
thiazinamium me... CAS#:58-34-4 |
| Literature: American Home Products Corporation Patent: US4097596 A1, 1978 ; |
|
Name: Activity against intracellular amastigotes of Trypanosoma cruzi (macrophage infection...
Source: ChEMBL
Target: N/A
External Id: CHEMBL808715
|
Total 1, Current Page 1 of 1
1
| dl-trimethyl[1-methyl-2-(phenothiazin-10-yl)ethyl]ammonium iodide |
| Trimethylammonium-isopropyl-phenthiazin jodid |
| Promethazin methoiodid |
| Methylsulfat |
| Promethazin-Methyliodid |
| Promethazine methiodide |
| Ammonium,(1-(phenothiazin-10-yl)-2-propyl)trimethyl-,iodide |
| Thiazinamium iodide |
| (1-(Phenothiazin-10-yl)-2-propyl)trimethylammonium iodide |
| trimethyl-(1-methyl-2-phenothiazin-10-yl-ethyl)-ammonium,iodide |
| thiazinamium metilsulfate |
| Promethazinum-methoiodide |
| 1-<Pheno-thiazinyl-10'>-Vb |
| Trimethylammonium-isopropyl-phenthiazin jodid [German] |
| dl-trimethyl[1-methyl-2-(phenothiazine-10-yl)ethyl]ammonium methyl sulfate |