7-chloro-3-oxo-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide structure
|
Common Name | 7-chloro-3-oxo-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 5800-59-9 | Molecular Weight | 232.64400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-chloro-3-oxo-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide |
|---|
| Molecular Formula | C7H5ClN2O3S |
|---|---|
| Molecular Weight | 232.64400 |
| Exact Mass | 231.97100 |
| PSA | 83.65000 |
| LogP | 2.71140 |
| InChIKey | SDCJBUKXFVQVKG-UHFFFAOYSA-N |
| SMILES | O=C1Nc2ccc(Cl)cc2S(=O)(=O)N1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Selectivity index, ratio of Ki for recombinant human carbonic anhydrase 2 to Ki for r...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4379874
|
|
Name: Selectivity index, ratio of Ki for recombinant human carbonic anhydrase 2 to Ki for r...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4379875
|