CHEMBRDG-BB 5954366
Modify Date: 2025-11-24 11:36:45
CHEMBRDG-BB 5954366 structure
|
Common Name | CHEMBRDG-BB 5954366 | ||
|---|---|---|---|---|
| CAS Number | 58064-57-6 | Molecular Weight | 270.14900 | |
| Density | 1.67g/cm3 | Boiling Point | 325.3ºC at 760 mmHg | |
| Molecular Formula | C9H8BrN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.5ºC | |
| Name | 3-(2-bromophenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 325.3ºC at 760 mmHg |
| Molecular Formula | C9H8BrN3S |
| Molecular Weight | 270.14900 |
| Flash Point | 150.5ºC |
| Exact Mass | 268.96200 |
| PSA | 65.70000 |
| LogP | 2.90720 |
| Index of Refraction | 1.721 |
| InChIKey | YCYXELBWIYJJNP-UHFFFAOYSA-N |
| SMILES | Cn1c(-c2ccccc2Br)n[nH]c1=S |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |