DMABA NHS ester structure
|
Common Name | DMABA NHS ester | ||
|---|---|---|---|---|
| CAS Number | 58068-85-2 | Molecular Weight | 262.261 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 416.4±47.0 °C at 760 mmHg | |
| Molecular Formula | C13H14N2O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 205.6±29.3 °C | |
Use of DMABA NHS esterDMABA NHS ester is a reagent that reacts with the primary amine group of PE lipids. |
| Name | DMABA NHS Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.4±47.0 °C at 760 mmHg |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.261 |
| Flash Point | 205.6±29.3 °C |
| Exact Mass | 262.095367 |
| PSA | 66.92000 |
| LogP | 0.36 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | FNGFZOAQGYOQTG-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)ON2C(=O)CCC2=O)cc1 |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,5-Pyrrolidinedione, 1-[[4-(dimethylamino)benzoyl]oxy]- |
| 1-{[4-(Dimethylamino)benzoyl]oxy}-2,5-pyrrolidinedione |
| (2,5-dioxopyrrolidin-1-yl) 4-(dimethylamino)benzoate |