Methyltetrazine-NHS ester structure
|
Common Name | Methyltetrazine-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1644644-96-1 | Molecular Weight | 327.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Methyltetrazine-NHS esterMethyltetrazine-Ph-NHS ester is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Methyltetrazine-Ph-NHS ester |
|---|---|
| Synonym | More Synonyms |
| Description | Methyltetrazine-Ph-NHS ester is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C15H13N5O4 |
|---|---|
| Molecular Weight | 327.29 |
| InChIKey | BIHJLZOOHNOUCG-UHFFFAOYSA-N |
| SMILES | Cc1nnc(-c2ccc(CC(=O)ON3C(=O)CCC3=O)cc2)nn1 |
| Hazard Codes | Xi |
|---|
| MFCD28334557 |