4-bromo-5-nitro-isoquinoline structure
|
Common Name | 4-bromo-5-nitro-isoquinoline | ||
|---|---|---|---|---|
| CAS Number | 58142-46-4 | Molecular Weight | 253.05200 | |
| Density | 1.747g/cm3 | Boiling Point | 379.9ºC at 760 mmHg | |
| Molecular Formula | C9H5BrN2O2 | Melting Point | 172-174 °C | |
| MSDS | N/A | Flash Point | 183.6ºC | |
| Name | 4-Bromo-5-nitroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.747g/cm3 |
|---|---|
| Boiling Point | 379.9ºC at 760 mmHg |
| Melting Point | 172-174 °C |
| Molecular Formula | C9H5BrN2O2 |
| Molecular Weight | 253.05200 |
| Flash Point | 183.6ºC |
| Exact Mass | 251.95300 |
| PSA | 58.71000 |
| LogP | 3.42870 |
| Index of Refraction | 1.707 |
| InChIKey | JAYGEXFKJUWRML-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2cncc(Br)c12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-nitro-4-bromoisoquinoline |
| 4-bromo-5-nitro-isoquinoline |
| 4-Brom-5-nitro-isochinolin |