5-Nitroisoquinoline structure
|
Common Name | 5-Nitroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 607-32-9 | Molecular Weight | 174.156 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 340.5±17.0 °C at 760 mmHg | |
| Molecular Formula | C9H6N2O2 | Melting Point | 106-109 °C(lit.) | |
| MSDS | N/A | Flash Point | 159.7±20.9 °C | |
| Name | 5-Nitroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.5±17.0 °C at 760 mmHg |
| Melting Point | 106-109 °C(lit.) |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.156 |
| Flash Point | 159.7±20.9 °C |
| Exact Mass | 174.042923 |
| PSA | 58.71000 |
| LogP | 1.69 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | PYGMPFQCCWBTJQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2cnccc12 |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/21/22;R38 |
| Safety Phrases | S26-S37/39-S36/37/39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitroisoquinoline |
| Isoquinoline,5-nitro |
| EINECS 210-133-8 |
| MFCD00006905 |
| 5-NO2-isoquinoline |
| 5-nitro isoquinoline |
| 5-nitroisochinolin |
| Isoquinoline, 5-nitro- |