Zinc bis[2-(1,3-benzothiazol-2-yl)phenolate]
![Zinc bis[2-(1,3-benzothiazol-2-yl)phenolate] Structure](https://image.chemsrc.com/caspic/485/58280-31-2.png)
Zinc bis[2-(1,3-benzothiazol-2-yl)phenolate] structure
|
Common Name | Zinc bis[2-(1,3-benzothiazol-2-yl)phenolate] | ||
|---|---|---|---|---|
| CAS Number | 58280-31-2 | Molecular Weight | 517.956 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H16N2O2S2Zn | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bis[2-(2-benzothiazolyl)phenolato]zinc(II) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H16N2O2S2Zn |
|---|---|
| Molecular Weight | 517.956 |
| Exact Mass | 515.994446 |
| PSA | 128.38000 |
| LogP | 8.21170 |
| InChIKey | XANIFASCQKHXRC-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1-c1nc2ccccc2s1.Oc1ccccc1-c1nc2ccccc2s1.[Zn] |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H315-H317-H319-H334-H335-H360 |
| Precautionary Statements | P201-P261-P280-P301 + P310-P305 + P351 + P338-P311 |
| Hazard Codes | Xi |
| Risk Phrases | 45-60-23/24/25-36/37/38-42/43 |
| Safety Phrases | 53-26-36/37-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 29339900 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:3411-95-8
CAS#:557-34-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| bis(2-(benzo[d]thiazol-2-yl)phenylbenzo[d]thiazol-2-yl)phenoxy)zinc |
| Bis[2-(2-hydroxyphenyl)benzothiazolato]zinc(II) |
| Phenol, 2-(2-benzothiazolyl)-, zinc salt (2:1) |
| Zinc bis[2-(1,3-benzothiazol-2-yl)phenolate] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of Bis[2-(2-benzothiazolyl)phenolato]zinc(II)? |
| A: LogP of Bis[2-(2-benzothiazolyl)phenolato]zinc(II) is 8.21170. |
| Q: What is the molecular formula of Bis[2-(2-benzothiazolyl)phenolato]zinc(II)? |
| A: Molecular formula of Bis[2-(2-benzothiazolyl)phenolato]zinc(II) is C26H16N2O2S2Zn. |
| Q: What is the InChIKey of Bis[2-(2-benzothiazolyl)phenolato]zinc(II)? |
| A: InChIKey of Bis[2-(2-benzothiazolyl)phenolato]zinc(II) is XANIFASCQKHXRC-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of Bis[2-(2-benzothiazolyl)phenolato]zinc(II)? |
| A: Polar surface area (PSA) of Bis[2-(2-benzothiazolyl)phenolato]zinc(II) is 128.38000. |
| Q: What is the English name of Bis[2-(2-benzothiazolyl)phenolato]zinc(II)? |
| A: The English name of Bis[2-(2-benzothiazolyl)phenolato]zinc(II) is Bis[2-(2-benzothiazolyl)phenolato]zinc(II). |
| Q: What is the molecular weight of Bis[2-(2-benzothiazolyl)phenolato]zinc(II)? |
| A: Molecular weight of Bis[2-(2-benzothiazolyl)phenolato]zinc(II) is 517.956. |
| Q: What English synonyms does Bis[2-(2-benzothiazolyl)phenolato]zinc(II) have? |
| A: English synonyms of Bis[2-(2-benzothiazolyl)phenolato]zinc(II): bis(2-(benzo[d]thiazol-2-yl)phenylbenzo[d]thiazol-2-yl)phenoxy)zinc, Bis[2-(2-hydroxyphenyl)benzothiazolato]zinc(II), Phenol, 2-(2-benzothiazolyl)-, zinc salt (2:1), Zinc bis[2-(1,3-benzothiazol-2-yl)phenolate]. |
| Q: What is the CAS number of Bis[2-(2-benzothiazolyl)phenolato]zinc(II)? |
| A: CAS number of Bis[2-(2-benzothiazolyl)phenolato]zinc(II) is 58280-31-2. |
| Q: What are the upstream materials of Bis[2-(2-benzothiazolyl)phenolato]zinc(II)? |
| A: Related upstream materials(CAS) of Bis[2-(2-benzothiazolyl)phenolato]zinc(II): 3411-95-8;557-34-6. |
| Q: What is the safety information for Bis[2-(2-benzothiazolyl)phenolato]zinc(II)? |
| A: Safety information for Bis[2-(2-benzothiazolyl)phenolato]zinc(II): 53-26-36/37-45. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |