[4-(2-nitropropan-2-yl)phenyl]-phenylmethanone structure
|
Common Name | [4-(2-nitropropan-2-yl)phenyl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 58324-79-1 | Molecular Weight | 269.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(2-nitropropan-2-yl)phenyl]-phenylmethanone |
|---|
| Molecular Formula | C16H15NO3 |
|---|---|
| Molecular Weight | 269.29500 |
| Exact Mass | 269.10500 |
| PSA | 62.89000 |
| LogP | 3.95260 |
| InChIKey | ZPIBPFBKDWRMRR-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(C(=O)c2ccccc2)cc1)[N+](=O)[O-] |
| HS Code | 2914700090 |
|---|
|
~36%
[4-(2-nitroprop... CAS#:58324-79-1 |
| Literature: Denney, Donald B.; Denney, Dorothy Z.; Perez, Airan Jun Tetrahedron, 1993 , vol. 49, # 21 p. 4463 - 4476 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |