4-Nitrobenzophenone structure
|
Common Name | 4-Nitrobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 1144-74-7 | Molecular Weight | 227.215 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 390.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H9NO3 | Melting Point | 136-138 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 190.7±16.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitrobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.5±25.0 °C at 760 mmHg |
| Melting Point | 136-138 °C(lit.) |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.215 |
| Flash Point | 190.7±16.0 °C |
| Exact Mass | 227.058243 |
| PSA | 62.89000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | ZYMCBJWUWHHVRX-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29147090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 29147090 |
|---|
| p-nitrobenzophenone |
| (4-Nitrophenyl)(phenyl)methanone |
| (4-nitrophenyl)-phenylmethanone |
| 4-Nitrobenzophenone |
| Methanone, (4-nitrophenyl)phenyl- |
| EINECS 214-542-2 |
| MFCD00007354 |
| 4-nitrophenyl phenyl ketone |
| Benzophenone, 4-nitro- |