Narasin sodium salt structure
|
Common Name | Narasin sodium salt | ||
|---|---|---|---|---|
| CAS Number | 58331-17-2 | Molecular Weight | 787.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H71NaO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Narasin sodium saltNarasin sodium is a cationic ionophore and coccidiostat agent. Narasin inhibits NF-κB signaling and induces tumor cells apoptosis. Narasin sodium has antimicrobial and anticancer activity[1]. |
| Name | naransin sodium |
|---|---|
| Synonym | More Synonyms |
| Description | Narasin sodium is a cationic ionophore and coccidiostat agent. Narasin inhibits NF-κB signaling and induces tumor cells apoptosis. Narasin sodium has antimicrobial and anticancer activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C43H71NaO11 |
|---|---|
| Molecular Weight | 787.01 |
| Exact Mass | 786.48900 |
| PSA | 164.04000 |
| LogP | 5.09930 |
| InChIKey | NBRZEFXQRCTYMC-UHFFFAOYSA-M |
| SMILES | CCC(C(=O)[O-])C1OC(C(C)C(O)C(C)C(=O)C(CC)C2OC3(C=CC(O)C4(CCC(C)(C5CCC(O)(CC)C(C)O5)O4)O3)C(C)CC2C)C(C)CC1C.[Na+] |
| natriumnarasin |
| NARASIN SODIUM |