4-[(4-chloroanilino)methyl]phenol structure
|
Common Name | 4-[(4-chloroanilino)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 58336-45-1 | Molecular Weight | 233.69300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-chloroanilino)methyl]phenol |
|---|
| Molecular Formula | C13H12ClNO |
|---|---|
| Molecular Weight | 233.69300 |
| Exact Mass | 233.06100 |
| PSA | 32.26000 |
| LogP | 3.73070 |
| InChIKey | ZDEUJEHDUBUXNW-UHFFFAOYSA-N |
| SMILES | Oc1ccc(CNc2ccc(Cl)cc2)cc1 |
| HS Code | 2922299090 |
|---|
|
~%
4-[(4-chloroani... CAS#:58336-45-1 |
| Literature: Noda et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 512,513,515 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |