5-(Benzyloxy)isobenzofuran-1,3-dione
5-(Benzyloxy)isobenzofuran-1,3-dione structure
|
Common Name | 5-(Benzyloxy)isobenzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5840-65-3 | Molecular Weight | 254.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(Benzyloxy)isobenzofuran-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10O4 |
|---|---|
| Molecular Weight | 254.24 |
| Exact Mass | 254.05790880 |
| PSA | 35.25000 |
| LogP | 4.16500 |
| InChIKey | ULTIREHJUYEDOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=O)OC3=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2932999099 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:64567-60-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-(Benzyloxy)isobenzofuran-1,3-dione? |
| A: The English name of 5-(Benzyloxy)isobenzofuran-1,3-dione is 5-(Benzyloxy)isobenzofuran-1,3-dione. |
| Q: What is the Chinese name of 5840-65-3? |
| A: Chinese name of 5840-65-3 is 5840-65-3. |
| Q: What is the SMILES notation of 5-(Benzyloxy)isobenzofuran-1,3-dione? |
| A: SMILES notation of 5-(Benzyloxy)isobenzofuran-1,3-dione is C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=O)OC3=O. |
| Q: What is the molecular formula of 5-(Benzyloxy)isobenzofuran-1,3-dione? |
| A: Molecular formula of 5-(Benzyloxy)isobenzofuran-1,3-dione is C15H10O4. |
| Q: What is the CAS number of 5-(Benzyloxy)isobenzofuran-1,3-dione? |
| A: CAS number of 5-(Benzyloxy)isobenzofuran-1,3-dione is 5840-65-3. |
| Q: What is the LogP of 5-(Benzyloxy)isobenzofuran-1,3-dione? |
| A: LogP of 5-(Benzyloxy)isobenzofuran-1,3-dione is 4.16500. |
| Q: What is the polar surface area (PSA) of 5-(Benzyloxy)isobenzofuran-1,3-dione? |
| A: Polar surface area (PSA) of 5-(Benzyloxy)isobenzofuran-1,3-dione is 35.25000. |
| Q: What is the molecular weight of 5-(Benzyloxy)isobenzofuran-1,3-dione? |
| A: Molecular weight of 5-(Benzyloxy)isobenzofuran-1,3-dione is 254.24. |
| Q: What is the InChIKey of 5-(Benzyloxy)isobenzofuran-1,3-dione? |
| A: InChIKey of 5-(Benzyloxy)isobenzofuran-1,3-dione is ULTIREHJUYEDOA-UHFFFAOYSA-N. |
| Q: What are the downstream products of 5-(Benzyloxy)isobenzofuran-1,3-dione? |
| A: Related downstream products(CAS) of 5-(Benzyloxy)isobenzofuran-1,3-dione: 64567-60-8. |