Peracetic acid 1-cyano-1-phenylpropyl ester structure
|
Common Name | Peracetic acid 1-cyano-1-phenylpropyl ester | ||
|---|---|---|---|---|
| CAS Number | 58422-70-1 | Molecular Weight | 219.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-cyano-1-phenylpropyl) ethaneperoxoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO3 |
|---|---|
| Molecular Weight | 219.23700 |
| Exact Mass | 219.09000 |
| PSA | 59.32000 |
| LogP | 2.31018 |
| InChIKey | PKYISRLYWKMDOE-UHFFFAOYSA-N |
| SMILES | CCC(C#N)(OOC(C)=O)c1ccccc1 |
|
~%
Peracetic acid ... CAS#:58422-70-1 |
| Literature: Freerksen; Pabst; Raggio; Sherman; Wroble; Watt Journal of the American Chemical Society, 1977 , vol. 99, # 5 p. 1536 - 1542 |
| 1-Cyano-1-phenylpropyl ethaneperoxoate |
| Ethaneperoxoic acid,1-cyano-1-phenylpropyl ester |