Peracetic acid 1-(4-chlorophenyl)-1-cyanoethyl ester structure
|
Common Name | Peracetic acid 1-(4-chlorophenyl)-1-cyanoethyl ester | ||
|---|---|---|---|---|
| CAS Number | 58422-80-3 | Molecular Weight | 239.65500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(4-chlorophenyl)-1-cyanoethyl] ethaneperoxoate |
|---|
| Molecular Formula | C11H10ClNO3 |
|---|---|
| Molecular Weight | 239.65500 |
| Exact Mass | 239.03500 |
| PSA | 59.32000 |
| LogP | 2.57348 |
| InChIKey | NARGGKXVLBHLSG-UHFFFAOYSA-N |
| SMILES | CC(=O)OOC(C)(C#N)c1ccc(Cl)cc1 |
|
~%
Peracetic acid ... CAS#:58422-80-3 |
| Literature: Freerksen; Pabst; Raggio; Sherman; Wroble; Watt Journal of the American Chemical Society, 1977 , vol. 99, # 5 p. 1536 - 1542 |