L-3-(2-Naphthyl)-alanine structure
|
Common Name | L-3-(2-Naphthyl)-alanine | ||
|---|---|---|---|---|
| CAS Number | 58438-03-2 | Molecular Weight | 215.248 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 412.3±33.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | -245ºC | |
| MSDS | N/A | Flash Point | 203.2±25.4 °C | |
Use of L-3-(2-Naphthyl)-alanineH-2-Nal-OH is an alanine derivative[1]. |
| Name | 3-(2-Naphthyl)-L-alanine |
|---|---|
| Synonym | More Synonyms |
| Description | H-2-Nal-OH is an alanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.3±33.0 °C at 760 mmHg |
| Melting Point | -245ºC |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.248 |
| Flash Point | 203.2±25.4 °C |
| Exact Mass | 215.094635 |
| PSA | 63.32000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.660 |
| InChIKey | JPZXHKDZASGCLU-LBPRGKRZSA-N |
| SMILES | NC(Cc1ccc2ccccc2c1)C(=O)O |
| Storage condition | 2-8°C |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| L-β-(2-Naphthyl)alanine |
| L-2-Nal-OH |
| 3-Naphth-2-yl-L-alanine |
| 3-(2-Naphthyl)alanine |
| β-(2-NAPHTHYL)-ALANINE |
| (2S)-2-amino-3-(2-naphthyl)propanoic acid |
| (S)-2-amino-3-(naphthalen-2-yl)propanoic acid |
| (2S)-2-amino-3-(naphthalen-2-yl)propanoic acid (non-preferred name) |
| β-2-Naphthyl-L-alanine |
| L-2-NAPTHYL ALANINE |
| (2S)-2-amino-3-naphthalen-2-yl-propanoic acid |
| UNII:W425Q6KV9R |
| β-(2-Naphthyl)-L-alanine |
| L-2-Naphthylalanine |
| 3-naphthalen-2-yl-L-alanine |
| MFCD03095595 |
| 2-Naphthalenepropanoic acid, α-amino-, (αS)- |
| 2-Naphthyl-L-Alanine |
| l-3-(2-naphthyl)alanine |
| H-2-Nal-OH.HCl |
| L-3-(2-Naphthyl)-alanine |
| 3-(2-Naphthyl)-Alanine |