(+)-N,N'-Diallyl-L-tartardiamide structure
|
Common Name | (+)-N,N'-Diallyl-L-tartardiamide | ||
|---|---|---|---|---|
| CAS Number | 58477-85-3 | Molecular Weight | 228.24500 | |
| Density | 1.192 g/cm3 | Boiling Point | 566.8ºC at 760 mmHg | |
| Molecular Formula | C10H16N2O4 | Melting Point | 186-188 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 296.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of (+)-N,N'-Diallyl-L-tartardiamideSolubility in Methanol:almost transparency |
| Name | n,n'-diallyl-l-tartardiamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192 g/cm3 |
|---|---|
| Boiling Point | 566.8ºC at 760 mmHg |
| Melting Point | 186-188 °C(lit.) |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.24500 |
| Flash Point | 296.6ºC |
| Exact Mass | 228.11100 |
| PSA | 98.66000 |
| Index of Refraction | 108 ° (C=2.4, H2O) |
| InChIKey | ZRKLEAHGBNDKHM-HTQZYQBOSA-N |
| SMILES | C=CCNC(=O)C(O)C(O)C(=O)NCC=C |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Investigating the reaction of a number of gel electrophoresis cross-linkers with beta-lactoglobulin by matrix assisted laser desorption/ionization-mass spectrometry.
Electrophoresis 21(17) , 3684-92, (2000) A number of cross-linkers that are commonly used in polyacrylamide gels have been incubated with bovine beta-lactoglobulin B and the resulting reaction mixtures were examined by matrix assisted laser ... |
|
|
Quantitative measurement of protein mass and radioactivity in N,N'-diallyltartardiamide crosslinked polyacrylamide slab gels.
Anal. Biochem. 108 , 202-206, (1980)
|
|
|
N-N' diallyltartardiamide (DATD) as a cross-linking agent for polyacrylamide gel disc electrophoresis of human serum proteins.
J. Postgrad. Med. 32(1) , 27-31, (1986)
|
| (+)-N,N'-diallyl-L-tartaradiamide |
| L-(+)-TARTARIC ACID DIALLYAMIDE |
| (+)-N,N'-DIALLYLTARTRAMIDE |
| L-(+)-N,N'-DIALLYL TARTARAMIDE |
| (+)-N,N'-DIALLYL-L-TARTRAMIDE |
| (2R,3R)-N,N'-Diallylweinsaeure-diamid |
| EINECS 261-277-3 |
| N,N'-DIALLYLTARTARDIAMIDE |
| (+)-L-N,N'-Diallylweinsaeurediamid |
| MFCD00008640 |
| (+)-DATD |