2-chloro-1,5-dinitro-3-phenylbenzene structure
|
Common Name | 2-chloro-1,5-dinitro-3-phenylbenzene | ||
|---|---|---|---|---|
| CAS Number | 58763-13-6 | Molecular Weight | 278.64800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-1,5-dinitro-3-phenylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7ClN2O4 |
|---|---|
| Molecular Weight | 278.64800 |
| Exact Mass | 278.00900 |
| PSA | 91.64000 |
| LogP | 4.86980 |
| InChIKey | PIKUKCDLSJEQNV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(-c2ccccc2)c(Cl)c([N+](=O)[O-])c1 |
|
~%
2-chloro-1,5-di... CAS#:58763-13-6 |
| Literature: Sen; Sharma Journal of the Indian Chemical Society, 1956 , vol. 33, p. 671,677 |
|
~%
2-chloro-1,5-di... CAS#:58763-13-6 |
| Literature: Borsche; Scholten Chemische Berichte, 1917 , vol. 50, p. 602 |
| 2-Chlor-3,5-dinitrobiphenyl |
| 2-chloro-3,5-dinitro-biphenyl |
| 1,1'-Biphenyl,2-chloro-3,5-dinitro |