Glycine,N-[4-(acetylamino)phenyl]- structure
|
Common Name | Glycine,N-[4-(acetylamino)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 588-92-1 | Molecular Weight | 208.21400 | |
| Density | 1.359g/cm3 | Boiling Point | 535.4ºC at 760mmHg | |
| Molecular Formula | C10H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.6ºC | |
| Name | 2-((4-acetamidophenyl)amino)acetic acid |
|---|
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 535.4ºC at 760mmHg |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.21400 |
| Flash Point | 277.6ºC |
| Exact Mass | 208.08500 |
| PSA | 78.43000 |
| LogP | 1.28750 |
| Index of Refraction | 1.657 |
| InChIKey | XOLVDWAUHOXWJA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(NCC(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |