Propacetamol HCl structure
|
Common Name | Propacetamol HCl | ||
|---|---|---|---|---|
| CAS Number | 66532-86-3 | Molecular Weight | 300.781 | |
| Density | N/A | Boiling Point | 434.5ºC at 760 mmHg | |
| Molecular Formula | C14H21ClN2O3 | Melting Point | 224-227ºC | |
| MSDS | N/A | Flash Point | 216.6ºC | |
Use of Propacetamol HClPropacetamol hydrochloride is an analgesic agent. Propacetamol hydrochloride also is a precursor form of paracetamol. Propacetamol hydrochloride can be used in postoperative pain, acute trauma and gastrointestinal disorders[1]. |
| Name | (4-acetamidophenyl) 2-(diethylamino)acetate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Propacetamol hydrochloride is an analgesic agent. Propacetamol hydrochloride also is a precursor form of paracetamol. Propacetamol hydrochloride can be used in postoperative pain, acute trauma and gastrointestinal disorders[1]. |
|---|---|
| Related Catalog |
| Boiling Point | 434.5ºC at 760 mmHg |
|---|---|
| Melting Point | 224-227ºC |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.781 |
| Flash Point | 216.6ºC |
| Exact Mass | 300.124084 |
| PSA | 58.64000 |
| LogP | 2.76720 |
| InChIKey | WGTYJNGARJPYKG-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)Oc1ccc(NC(C)=O)cc1.Cl |
| Storage condition | -20℃ |
| HS Code | 2942000000 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Propacetamol HCl |
| 4-Acetamidophenyl N,N-diethylglycinate hydrochloride (1:1) |
| Pro-efferalgan |
| MFCD00941392 |
| PropacetamolHydrochloride |
| 4-(Acetylamino)phenyl N,N-diethylglycinate hydrochloride |
| 4-(acetylamino)phenyl N,N-diethylglycinate hydrochloride (1:1) |
| 4-Acetamidophenyl (diethylamino)acetate hydrochloride |
| Glycine, N,N-diethyl-, 4-(acetylamino)phenyl ester, hydrochloride (1:1) |
| Glycine, N,N-diethyl-, 4-(acetylamino)phenyl ester, monohydrochloride |
| 4-Acetamidophenyl N,N-diethylglycinate hydrochloride |
| 4-(Acetylamino)phenyl-N,N-diethylglycinathydrochlorid |
| EINECS 266-391-7 |
| Propacetamol Hydrochloride |