Ofurace structure
|
Common Name | Ofurace | ||
|---|---|---|---|---|
| CAS Number | 58810-48-3 | Molecular Weight | 281.73 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 482.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H16ClNO3 | Melting Point | 145 - 146ºC | |
| MSDS | Chinese USA | Flash Point | 245.8±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of OfuraceOfurace is a fungicide that is extremely active against Pythium ultima, Phytophthora tabacum and Phytophthora palmi. Ofurace has a greater effect on sporangia formation than on mycelium growth[1]. |
| Name | ofurace |
|---|---|
| Synonym | More Synonyms |
| Description | Ofurace is a fungicide that is extremely active against Pythium ultima, Phytophthora tabacum and Phytophthora palmi. Ofurace has a greater effect on sporangia formation than on mycelium growth[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 482.7±45.0 °C at 760 mmHg |
| Melting Point | 145 - 146ºC |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.73 |
| Flash Point | 245.8±28.7 °C |
| Exact Mass | 281.081879 |
| PSA | 46.61000 |
| LogP | 0.93 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | OWDLFBLNMPCXSD-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1N(C(=O)CCl)C1CCOC1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36 |
| Safety Phrases | S36 |
| RIDADR | NONH for all modes of transport |
| RTECS | AE1300200 |
|
Effect of ofurace, oxadixyl, and alachlor on xenobiotic biotransformation in the rat liver.
Arch. Environ. Contam. Toxicol. 18(6) , 876-80, (1989) Ofurace, oxadixyl, and alachlor were studied for their effect on hepatic xenobiotic biotransformation in male rats by dosing i.p. with 1 or 100 mg/kg of chemical for 7 days. Ofurace decreased ethoxyre... |
| Acetamide, 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)- |
| EINECS 261-451-9 |
| 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furyl)acetamide |
| 2-chloro-2',6'-dimethyl-N-(2-oxo-tetrahydro-3-furanyl)-acetanilide |
| 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)acetamide |
| 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxooxolan-3-yl)acetamide |
| MFCD01632753 |
| 1653655 |
| 2-Chloro-N-(2,6-dimethylphenyl)-N-(2-oxotetrahydrofuran-3-yl)acetamide |
| N-(tetrahydrofuran-2-on-3-yl)-N-(2,6-dimethylphenyl)-2-chloroacetamide |
| 2-Chlor-N-(2,6-dimethylphenyl)-N-(2-oxotetrahydrofuran-3-yl)acetamid |
| rac-2-chloro-N-(2,6-dimethylphenyl)-N-[(3R)-2-oxooxolan-3-yl]acetamide |
| 2-chloro-N-(2,6-dimethyl-phenyl)-N-(2-oxo-tetrahydro-furan-3-yl)-acetamide |
| Ofurace [ANSI:BSI:ISO] |
| (RS)-α-(2-Chloro-N-2,6-xylylacetamido)-γ-butyrolactone |
| 2-Chloro-N-(2,6-dimethylphenyl)-N-(2-oxotetrahydro-3-furanyl)acetamide |
| Ofurace |
| Milfuram |
| 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2--oxo-3-furanyl)-acetamide |