2-(2-chloro-5-methylphenoxy)propanehydrazide structure
|
Common Name | 2-(2-chloro-5-methylphenoxy)propanehydrazide | ||
|---|---|---|---|---|
| CAS Number | 588680-01-7 | Molecular Weight | 228.67500 | |
| Density | 1.238g/cm3 | Boiling Point | 432.6ºC at 760 mmHg | |
| Molecular Formula | C10H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.4ºC | |
| Name | 2-(2-chloro-5-methylphenoxy)propanehydrazide |
|---|
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 432.6ºC at 760 mmHg |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.67500 |
| Flash Point | 215.4ºC |
| Exact Mass | 228.06700 |
| PSA | 64.35000 |
| LogP | 2.49680 |
| Index of Refraction | 1.552 |
| InChIKey | GFSYSNACBDIEIP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c(OC(C)C(=O)NN)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |