1-(4-FLUOROPHENYL)-2-(1H-1,2,4-TRIAZOLE-1-YL)ETHANONE structure
|
Common Name | 1-(4-FLUOROPHENYL)-2-(1H-1,2,4-TRIAZOLE-1-YL)ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 58905-21-8 | Molecular Weight | 205.19 | |
| Density | 1.307g/cm3 | Boiling Point | 396.111ºC at 760 mmHg | |
| Molecular Formula | C10H8FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.361ºC | |
| Name | 1-(4-fluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.307g/cm3 |
|---|---|
| Boiling Point | 396.111ºC at 760 mmHg |
| Molecular Formula | C10H8FN3O |
| Molecular Weight | 205.19 |
| Flash Point | 193.361ºC |
| Exact Mass | 205.06514005 |
| PSA | 9.23000 |
| LogP | 2.06770 |
| Index of Refraction | 1.609 |
| InChIKey | IKOAKIRZMHXFFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CN2C=NC=N2)F |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(1,2,4-triazol-1-yl)-4'-fluoroacetophenone |
| 4'-fluoro-2-(1H-1,2,4-triazol-1-yl)acetophenone |
| 1-(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)-ethanone |
| 1-(4-Fluorophenyl)-2-(1H-1,2,4-triazole-1-yl)ethanone |
| 2-(1H-1,2,4-triazol-1-yl)-4'-fluoroacetophenone |