Thiotriazinone structure
|
Common Name | Thiotriazinone | ||
|---|---|---|---|---|
| CAS Number | 58909-39-0 | Molecular Weight | 159.166 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 272.3±23.0 °C at 760 mmHg | |
| Molecular Formula | C4H5N3O2S | Melting Point | 168-171 °C(lit.) | |
| MSDS | N/A | Flash Point | 118.5±22.6 °C | |
| Name | Tetrahydro-2-Methyl-3-Thioxo-1,2,4-Triazine-5,6-Dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.3±23.0 °C at 760 mmHg |
| Melting Point | 168-171 °C(lit.) |
| Molecular Formula | C4H5N3O2S |
| Molecular Weight | 159.166 |
| Flash Point | 118.5±22.6 °C |
| Exact Mass | 159.010239 |
| PSA | 102.74000 |
| LogP | -1.38 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.759 |
| InChIKey | UMWWHOXOVPIGFD-UHFFFAOYSA-N |
| SMILES | Cn1[nH]c(=O)c(=O)[nH]c1=S |
| Storage condition | Refrigerator |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| EINECS 261-490-1 |
| Tetrahydro-2-methyl-3-thioxo-1,2,4-triazine-5,6-dione |
| 1,2,4-Triazine-5,6-dione, tetrahydro-2-methyl-3-thioxo- |
| 3-Mercapto-2-Methyl-5-oxo-6-Hydroxy-1,2,4-Triazine[TTZ,OHMMT] |
| 2-methyl-3-sulfanylidene-1,2,4-triazinane-5,6-dione |
| 2-Methyl-3-thioxo-1,2,4-triazinane-5,6-dione |
| MFCD06410922 |
| Ceftriaxone Impurity 3 |