2'-[3-(tert-butylamino)-2-hydroxypropoxy]-5'-fluorobutyrophenone structure
|
Common Name | 2'-[3-(tert-butylamino)-2-hydroxypropoxy]-5'-fluorobutyrophenone | ||
|---|---|---|---|---|
| CAS Number | 58930-32-8 | Molecular Weight | 311.392 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 441.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H26FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.0±28.7 °C | |
Use of 2'-[3-(tert-butylamino)-2-hydroxypropoxy]-5'-fluorobutyrophenoneButofilolol is a potent β-blocking agent used in the research of hypertension[1]. |
| Name | Butofilolol |
|---|---|
| Synonym | More Synonyms |
| Description | Butofilolol is a potent β-blocking agent used in the research of hypertension[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.8±45.0 °C at 760 mmHg |
| Molecular Formula | C17H26FNO3 |
| Molecular Weight | 311.392 |
| Flash Point | 221.0±28.7 °C |
| Exact Mass | 311.189667 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | NMBNQRJDEPOXCP-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1cc(F)ccc1OCC(O)CNC(C)(C)C |
| 1-{2-[3-(tert-Butylamino)-2-hydroxypropoxy]-5-fluorophenyl}-1-butanone |
| MFCD00864575 |
| EINECS 261-502-5 |
| Butofilolol, (R)- |
| UNII:4AZC6Y5A8G |
| 4459 |
| 4AZC6Y5A8G |
| Butofilolol |