5,12-Naphthacenedione,1,4-dihydro-6,11-dimethoxy- structure
|
Common Name | 5,12-Naphthacenedione,1,4-dihydro-6,11-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 58977-01-8 | Molecular Weight | 320.33900 | |
| Density | 1.32g/cm3 | Boiling Point | 569.3ºC at 760mmHg | |
| Molecular Formula | C20H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.1ºC | |
| Name | 6,11-dimethoxy-1,4-dihydrotetracene-5,12-dione |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 569.3ºC at 760mmHg |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.33900 |
| Flash Point | 253.1ºC |
| Exact Mass | 320.10500 |
| PSA | 52.60000 |
| LogP | 3.88260 |
| Index of Refraction | 1.665 |
| InChIKey | VMNKLMJBEAHUAO-UHFFFAOYSA-N |
| SMILES | COc1c2c(c(OC)c3ccccc13)C(=O)C1=C(CC=CC1)C2=O |
|
~%
5,12-Naphthacen... CAS#:58977-01-8 |
| Literature: Lee; Martinez; Smith; Henry Journal of Organic Chemistry, 1976 , vol. 41, # 13 p. 2296 - 2303 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |