5,12-Naphthacenedione,1,4,4a,12a-tetrahydro-6,11-dihydroxy structure
|
Common Name | 5,12-Naphthacenedione,1,4,4a,12a-tetrahydro-6,11-dihydroxy | ||
|---|---|---|---|---|
| CAS Number | 58976-92-4 | Molecular Weight | 294.30100 | |
| Density | 1.432g/cm3 | Boiling Point | 604ºC at 760mmHg | |
| Molecular Formula | C18H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.1ºC | |
| Name | 6,11-dihydroxy-1,4,4a,12a-tetrahydrotetracene-5,12-dione |
|---|
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 604ºC at 760mmHg |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.30100 |
| Flash Point | 333.1ºC |
| Exact Mass | 294.08900 |
| PSA | 74.60000 |
| LogP | 3.21240 |
| Index of Refraction | 1.718 |
| InChIKey | UHYZMMFCWWYSAM-UHFFFAOYSA-N |
| SMILES | O=C1c2c(c(O)c3ccccc3c2O)C(=O)C2CC=CCC12 |
|
~%
5,12-Naphthacen... CAS#:58976-92-4 |
| Literature: Lee; Martinez; Smith; Henry Journal of Organic Chemistry, 1976 , vol. 41, # 13 p. 2296 - 2303 |
|
~%
5,12-Naphthacen... CAS#:58976-92-4 |
| Literature: Lee; Martinez; Smith; Henry Journal of Organic Chemistry, 1976 , vol. 41, # 13 p. 2296 - 2303 |