3-(2-cyclohexylethyl)-4-ethyl-1H-1,2,4-triazole-5-thione structure
|
Common Name | 3-(2-cyclohexylethyl)-4-ethyl-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 590353-07-4 | Molecular Weight | 239.38000 | |
| Density | 1.21g/cm3 | Boiling Point | 320.2ºC at 760 mmHg | |
| Molecular Formula | C12H21N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.4ºC | |
| Name | 3-(2-cyclohexylethyl)-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 320.2ºC at 760 mmHg |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.38000 |
| Flash Point | 147.4ºC |
| Exact Mass | 239.14600 |
| PSA | 69.51000 |
| LogP | 3.09960 |
| Index of Refraction | 1.629 |
| InChIKey | SHDJEDZJMWZKNV-UHFFFAOYSA-N |
| SMILES | CCn1c(CCC2CCCCC2)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |