1,3-bis[(2-ethylhexyl)oxy]propan-2-ol structure
|
Common Name | 1,3-bis[(2-ethylhexyl)oxy]propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 59068-03-0 | Molecular Weight | 316.51900 | |
| Density | 0.895g/cm3 | Boiling Point | 402.5ºC at 760 mmHg | |
| Molecular Formula | C19H40O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.2ºC | |
| Name | 1,3-bis(2-ethylhexoxy)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.895g/cm3 |
|---|---|
| Boiling Point | 402.5ºC at 760 mmHg |
| Molecular Formula | C19H40O3 |
| Molecular Weight | 316.51900 |
| Flash Point | 197.2ºC |
| Exact Mass | 316.29800 |
| PSA | 38.69000 |
| LogP | 4.81330 |
| Index of Refraction | 1.449 |
| InChIKey | PHAAUEVTVVDDGA-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COCC(O)COCC(CC)CCCC |
|
~83%
1,3-bis[(2-ethy... CAS#:59068-03-0 |
| Literature: KAO Corporation Patent: US2012/4470 A1, 2012 ; Location in patent: Page/Page column 5 ; |
|
~0%
1,3-bis[(2-ethy... CAS#:59068-03-0
Detail
|
| Literature: Rohm and Haas Company; Dow Global Technologies LLC Patent: EP2426099 A1, 2012 ; Location in patent: Page/Page column 5-6 ; |
|
~%
1,3-bis[(2-ethy... CAS#:59068-03-0 |
| Literature: Rogers; Henze Journal of the American Chemical Society, 1940 , vol. 62, p. 1759 |
| 1,3-Bis-(2-aethyl-hexyloxy)-propan-2-ol |
| 1,3-di-(2-ethylhexyl)glycerol |
| Glycerin-1.3-bis-(2-aethyl-hexylaether) |
| 1,3-di(2-ethylhexyloxy)-2-propanol |
| 1,3-di(2-ethylhexoxy)-2-propanol |
| 5,13-diethyl-7,11-dioxa-9-heptadecanol |
| 1,3-Bis((2-ethylhexyl)oxy)propan-2-ol |
| EINECS 261-587-9 |