Hexyl beta-D-glucopyranoside structure
|
Common Name | Hexyl beta-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 59080-45-4 | Molecular Weight | 264.31500 | |
| Density | 1.23 g/cm3 | Boiling Point | 432.3ºC at 760 mmHg | |
| Molecular Formula | C12H24O6 | Melting Point | 84-86°C | |
| MSDS | Chinese USA | Flash Point | 215.2ºC | |
| Name | Hexyl β-D-Glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23 g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760 mmHg |
| Melting Point | 84-86°C |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.31500 |
| Flash Point | 215.2ºC |
| Exact Mass | 264.15700 |
| PSA | 99.38000 |
| Index of Refraction | 1.521 |
| InChIKey | JVAZJLFFSJARQM-RMPHRYRLSA-N |
| SMILES | CCCCCCOC1OC(CO)C(O)C(O)C1O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29389090 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
n-Alkyl-glucosides as detergents for the preparation of highly homogeneous bilayer liposomes of variable sizes ( 60-240 nm phi) applying defined rates of detergent removal by dialysis.
Biochem. Biophys. Res. Commun. 100 , 1055, (1981)
|
| (2R,3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| MFCD00063305 |