1-(2-nitrophenyl)piperazin structure
|
Common Name | 1-(2-nitrophenyl)piperazin | ||
|---|---|---|---|---|
| CAS Number | 59084-06-9 | Molecular Weight | 207.229 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 369.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.4±23.7 °C | |
| Name | 1-(2-Nitrophenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.7±27.0 °C at 760 mmHg |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.229 |
| Flash Point | 177.4±23.7 °C |
| Exact Mass | 207.100784 |
| PSA | 61.09000 |
| LogP | 2.04 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | YJRCDSXLKPERNV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1N1CCNCC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933599090 |
|
~92%
1-(2-nitropheny... CAS#:59084-06-9 |
| Literature: Synaptic Pharmaceutical Corporation Patent: US6245773 B1, 2001 ; US 6245773 B1 |
|
~%
1-(2-nitropheny... CAS#:59084-06-9 |
| Literature: Helvetica Chimica Acta, , vol. 39, p. 1144,1154 |
|
~%
1-(2-nitropheny... CAS#:59084-06-9 |
| Literature: Tetrahedron Letters, , vol. 38, # 23 p. 4091 - 4094 |
|
~48%
1-(2-nitropheny... CAS#:59084-06-9 |
| Literature: Tetrahedron Letters, , vol. 40, # 31 p. 5661 - 5665 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-nitrophenyl)piperazin |
| MFCD00040728 |
| nitrophenylpiperazine |
| EINECS 261-593-1 |
| 1-(2-Nitrophenyl)piperazine |
| Piperazine, 1-(2-nitrophenyl)- |