dimethyl 5-(5-formyl-2-furyl)isophthalate structure
|
Common Name | dimethyl 5-(5-formyl-2-furyl)isophthalate | ||
|---|---|---|---|---|
| CAS Number | 591226-59-4 | Molecular Weight | 288.25200 | |
| Density | 1.281g/cm3 | Boiling Point | 464.8ºC at 760 mmHg | |
| Molecular Formula | C15H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.9ºC | |
| Name | dimethyl 5-(5-formylfuran-2-yl)benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 464.8ºC at 760 mmHg |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25200 |
| Flash Point | 234.9ºC |
| Exact Mass | 288.06300 |
| PSA | 82.81000 |
| LogP | 2.33230 |
| Index of Refraction | 1.566 |
| InChIKey | VSJXHGDTDJNQEZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc(C=O)o2)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| bb_sc-0427 |