(E/Z)-ZINC09659342 structure
|
Common Name | (E/Z)-ZINC09659342 | ||
|---|---|---|---|---|
| CAS Number | 591726-26-0 | Molecular Weight | 440.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H15F3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (E/Z)-ZINC09659342(E/Z)-ZINC09659342 is an inhibitor of Lbc-RhoA interaction[1]. |
| Name | (E/Z)-ZINC09659342 |
|---|
| Description | (E/Z)-ZINC09659342 is an inhibitor of Lbc-RhoA interaction[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H15F3N2O4 |
|---|---|
| Molecular Weight | 440.37 |
| InChIKey | SFVRJPWNVAZKMP-XDHOZWIPSA-N |
| SMILES | CC1=NN(c2ccc(C(=O)O)cc2)C(=O)C1=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1 |