N-benzyl-2-[(4-ethylphenyl)carbamoyl-(oxolan-2-ylmethyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide structure
|
Common Name | N-benzyl-2-[(4-ethylphenyl)carbamoyl-(oxolan-2-ylmethyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5919-13-1 | Molecular Weight | 505.67200 | |
| Density | 1.215g/cm3 | Boiling Point | 723.2ºC at 760 mmHg | |
| Molecular Formula | C29H35N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.2ºC | |
| Name | N-benzyl-2-[(4-ethylphenyl)carbamoyl-(oxolan-2-ylmethyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 723.2ºC at 760 mmHg |
| Molecular Formula | C29H35N3O3S |
| Molecular Weight | 505.67200 |
| Flash Point | 391.2ºC |
| Exact Mass | 505.24000 |
| PSA | 90.12000 |
| LogP | 5.93380 |
| Index of Refraction | 1.621 |
| InChIKey | GBMFSBZHKYZYNW-UHFFFAOYSA-N |
| SMILES | CCc1ccc(NC(=O)N(CC(=O)N(Cc2ccccc2)Cc2sccc2C)CC2CCCO2)cc1 |
|
~%
N-benzyl-2-[(4-... CAS#:5919-13-1 |
| Literature: Gilman et al. Journal of the American Chemical Society, 1939 , vol. 61, p. 2836,2842 |
| 1-(4-methoxydibenzo[b,d]furan-1-yl)-1-ethanone |
| 1-(4-methoxy-dibenzofuran-1-yl)-ethanone |
| 1-(4-Methoxy-dibenzofuran-1-yl)-aethanon |
| 1-Acetyl-4-methoxy-dibenzofuran |