Methyl 6-methoxy-5-nitronicotinate structure
|
Common Name | Methyl 6-methoxy-5-nitronicotinate | ||
|---|---|---|---|---|
| CAS Number | 59237-49-9 | Molecular Weight | 212.160 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 331.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.0±26.5 °C | |
| Name | Methyl 6-methoxy-5-nitronicotinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.0±37.0 °C at 760 mmHg |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.160 |
| Flash Point | 154.0±26.5 °C |
| Exact Mass | 212.043320 |
| PSA | 94.24000 |
| LogP | 1.24 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | YVGHVJUGJZGYPW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cnc(OC)c([N+](=O)[O-])c1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
|
~95%
Methyl 6-methox... CAS#:59237-49-9 |
| Literature: Almirall, S.A. Patent: EP2527344 A1, 2012 ; Location in patent: Page/Page column 24 ; EP 2527344 A1 |
|
~%
Methyl 6-methox... CAS#:59237-49-9 |
| Literature: Aventis Pharma Limited Patent: US6472412 B1, 2002 ; |
|
~%
Methyl 6-methox... CAS#:59237-49-9 |
| Literature: RHONE-POULENC RORER LIMITED Patent: EP741707 B1, 1998 ; |
|
~%
Methyl 6-methox... CAS#:59237-49-9 |
| Literature: Almirall, S.A. Patent: EP2527344 A1, 2012 ; EP 2527344 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Pyridinecarboxylic acid, 6-methoxy-5-nitro-, methyl ester |
| Methyl 6-methoxy-5-nitronicotinate |
| methyl 6-methoxy-5-nitropyridine-3-carboxylate |