Bis-acrylate-PEG5 structure
|
Common Name | Bis-acrylate-PEG5 | ||
|---|---|---|---|---|
| CAS Number | 59256-52-9 | Molecular Weight | 346.37300 | |
| Density | 1.098g/cm3 | Boiling Point | 421.5ºC at 760 mmHg | |
| Molecular Formula | C16H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9ºC | |
Use of Bis-acrylate-PEG5Bis-acrylate-PEG5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-acrylate-PEG5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 421.5ºC at 760 mmHg |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.37300 |
| Flash Point | 181.9ºC |
| Exact Mass | 346.16300 |
| PSA | 89.52000 |
| LogP | 0.51120 |
| Index of Refraction | 1.458 |
| InChIKey | IJUOZEBZJUUBNX-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOCCOCCOCCOCCOC(=O)C=C |
| EINECS 261-677-8 |
| 16-oxo-3,6,9,12,15-pentaoxaoctadec-17-en-1-yl acrylate |
| 3,6,9,12-Tetraoxatetradecane-1,14-diyl diacrylate |