7H-Perfluoroheptanoyl fluoride
Modify Date: 2025-08-25 09:12:21
7H-Perfluoroheptanoyl fluoride structure
|
Common Name | 7H-Perfluoroheptanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 5927-65-1 | Molecular Weight | 348.06100 | |
| Density | 1.636g/cm3 | Boiling Point | 91ºC | |
| Molecular Formula | C7HF13O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 40ºC | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.636g/cm3 |
|---|---|
| Boiling Point | 91ºC |
| Molecular Formula | C7HF13O |
| Molecular Weight | 348.06100 |
| Flash Point | 40ºC |
| Exact Mass | 347.98200 |
| PSA | 17.07000 |
| LogP | 3.92410 |
| Index of Refraction | 1.272 |
| InChIKey | ZEZLMEWVHJPIDP-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3265 |
| HS Code | 2915900090 |
|
~%
7H-Perfluorohep... CAS#:5927-65-1 |
| Literature: Journal of Organic Chemistry, , vol. 42, # 25 p. 4055 - 4058 |
|
~%
7H-Perfluorohep... CAS#:5927-65-1 |
| Literature: Journal of Organic Chemistry, , vol. 42, # 25 p. 4055 - 4058 |
CAS#:918-22-9
CAS#:128957-66-4| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 7H-Perfluoroheptanoyl fluoride |
| Perfluoro-7-hydroheptaldehyd |
| PC3131G |