2-Iodo-1,5-dimethyl-3-nitrobenzene structure
|
Common Name | 2-Iodo-1,5-dimethyl-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 593255-20-0 | Molecular Weight | 277.05900 | |
| Density | 1.777±0.06 g/cm3(Predicted) | Boiling Point | 320.0±30.0 °C(Predicted) | |
| Molecular Formula | C8H8INO2 | Melting Point | 102-107 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 1-Iodo-2,4-dimethyl-6-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.777±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 320.0±30.0 °C(Predicted) |
| Melting Point | 102-107 °C |
| Molecular Formula | C8H8INO2 |
| Molecular Weight | 277.05900 |
| Exact Mass | 276.96000 |
| PSA | 45.82000 |
| LogP | 3.33940 |
| InChIKey | IHFAHQKEKVTXOG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(I)c([N+](=O)[O-])c1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2904909090 |
|
~68%
2-Iodo-1,5-dime... CAS#:593255-20-0 |
| Literature: Liang, Yuxue; Gao, Shuang; Wan, Huihui; Wang, Junwei; Chen, Huilin; Zheng, Zhuo; Hu, Xinquan Tetrahedron Asymmetry, 2003 , vol. 14, # 10 p. 1267 - 1273 |
|
~%
2-Iodo-1,5-dime... CAS#:593255-20-0 |
| Literature: Liang, Yuxue; Gao, Shuang; Wan, Huihui; Wang, Junwei; Chen, Huilin; Zheng, Zhuo; Hu, Xinquan Tetrahedron Asymmetry, 2003 , vol. 14, # 10 p. 1267 - 1273 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Iodo-1,5-dimethyl-3-nitrobenzene |