ethyl (3-formyl-4-nitro-phenyl) carbonate structure
|
Common Name | ethyl (3-formyl-4-nitro-phenyl) carbonate | ||
|---|---|---|---|---|
| CAS Number | 59342-81-3 | Molecular Weight | 239.18200 | |
| Density | 1.379g/cm3 | Boiling Point | 404.7ºC at 760 mmHg | |
| Molecular Formula | C10H9NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.5ºC | |
| Name | ethyl (3-formyl-4-nitrophenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 404.7ºC at 760 mmHg |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.18200 |
| Flash Point | 193.5ºC |
| Exact Mass | 239.04300 |
| PSA | 98.42000 |
| LogP | 2.46580 |
| Index of Refraction | 1.574 |
| InChIKey | XDSNNVUKVKTMCB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Oc1ccc([N+](=O)[O-])c(C=O)c1 |
|
~%
ethyl (3-formyl... CAS#:59342-81-3 |
| Literature: Mason Journal of the Chemical Society, 1925 , vol. 127, p. 1199 |
|
~%
ethyl (3-formyl... CAS#:59342-81-3 |
| Literature: Mason Journal of the Chemical Society, 1925 , vol. 127, p. 1199 |
| 3-formyl-4-nitrophenyl ethyl carbonate |
| carbonic acid ethyl ester-(3-formyl-4-nitro-phenyl ester) |
| Ethyl-3-formyl-4-nitrophenyl-carbonat |
| Kohlensaeure-aethylester-(3-formyl-4-nitro-phenylester) |
| ethyl (3-formyl-4-nitro-phenyl) carbonate |