Darutigenol structure
|
Common Name | Darutigenol | ||
|---|---|---|---|---|
| CAS Number | 5940-00-1 | Molecular Weight | 322.482 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 471.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.7±23.3 °C | |
Use of DarutigenolDarutigenol is an ent-pimarane-type diterpenoid isolated from Siegesbecikia orientalis L.[1]. |
| Name | Darutigenol |
|---|---|
| Synonym | More Synonyms |
| Description | Darutigenol is an ent-pimarane-type diterpenoid isolated from Siegesbecikia orientalis L.[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 471.2±45.0 °C at 760 mmHg |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.482 |
| Flash Point | 210.7±23.3 °C |
| Exact Mass | 322.250793 |
| PSA | 60.69000 |
| LogP | 3.50 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | NCAZLDCEJHFJDT-KHKZNYETSA-N |
| SMILES | CC1(C(O)CO)C=C2CCC3C(C)(C)C(O)CCC3(C)C2CC1 |
| Hazard Codes | Xi |
|---|
| Darutigel |
| (3α,5β,9β,10α,13α,15R)-Pimar-8(14)-ene-3,15,16-triol |
| 1,2-Ethanediol, 1-[(2S,4aR,4bS,7R,8aS)-2,3,4,4a,4b,5,6,7,8,8a,9,10-dodecahydro-7-hydroxy-2,4b,8,8-tetramethyl-2-phenanthrenyl]-, (1R)- |