4-benzyloxy-3-chloroaniline 96 structure
|
Common Name | 4-benzyloxy-3-chloroaniline 96 | ||
|---|---|---|---|---|
| CAS Number | 59404-86-3 | Molecular Weight | 233.69300 | |
| Density | 1.24g/cm3 | Boiling Point | 390.6ºC at 760 mmHg | |
| Molecular Formula | C13H12ClNO | Melting Point | 56-60ºC(lit.) | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | 3-chloro-4-phenylmethoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 390.6ºC at 760 mmHg |
| Melting Point | 56-60ºC(lit.) |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.69300 |
| Flash Point | 190ºC |
| Exact Mass | 233.06100 |
| PSA | 35.25000 |
| LogP | 4.08240 |
| Index of Refraction | 1.624 |
| InChIKey | WOWKZTBVWKKGJV-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OCc2ccccc2)c(Cl)c1 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Benzyloxy-3-chloroaniline |
| MFCD03427265 |