Azomethine-H monosodium structure
|
Common Name | Azomethine-H monosodium | ||
|---|---|---|---|---|
| CAS Number | 5941-07-1 | Molecular Weight | 463.414 | |
| Density | 1.823g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H12NNaO8S2 | Melting Point | >300°C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azomethine-H monosodiumAzomethine-H monosodium is a colour-forming reagent. Azomethine-H monosodium is also a reagent for boron determinations[1][2]. |
| Name | 8-Hydroxy-1-(salicylideneamino)naphthalene-3,6-disulfonic Acid Monosodium Salt |
|---|---|
| Synonym | More Synonyms |
| Description | Azomethine-H monosodium is a colour-forming reagent. Azomethine-H monosodium is also a reagent for boron determinations[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Azomethine-H monosodium is used for the manual determination of boron in complex borenes and boranes[2]. |
| References |
| Density | 1.823g/cm3 |
|---|---|
| Melting Point | >300°C |
| Molecular Formula | C17H12NNaO8S2 |
| Molecular Weight | 463.414 |
| Exact Mass | 463.000763 |
| PSA | 181.15000 |
| LogP | 4.31400 |
| Index of Refraction | 1.81 |
| InChIKey | DCVVWHMUGIOBJJ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(O)c2c(N=Cc3ccccc3O)cc(S(=O)(=O)O)cc2c1.[Na] |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
| azomethine h |
| 2,7-naphthalenedisulfonicacid, 4-hydroxy-5-[[(2-hydroxyphenyl)methylene]amino]-, sodium salt (1:1) |
| azomethine-h monosodium salt |
| 2,7-Naphthalenedisulfonic acid, 4-hydroxy-5-[[(1E)-(2-hydroxyphenyl)methylene]amino]-, sodium salt, hydrate (1:1:1) |
| MFCD00042050 |
| Sodium 5-hydroxy-4-[(E)-(2-hydroxybenzylidene)amino]-7-sulfo-2-naphthalenesulfonate hydrate (1:1:1) |
| 4-hydroxy-5-[salicylideneamino]-2,7-naphthalenedisulfonic acid sodium salt |
| 4-hydroxy-5-[salicylideneamino]-2,7-naphthalenedisulfonicacidsodiumsalt |
| EINECS 227-698-1 |
| Hydrogen sodium 4-hydroxy-5-[(2-hydroxybenzylidene)amino]naphthalene-2,7-disulfonate (1:1:1) |
| 2,7-Naphthalenedisulfonate, 4-hydroxy-5-[[(2-hydroxyphenyl)methylene]amino]-, hydrogen sodium salt (1:1:1) |
| Hydrogen sodium 4-hydroxy-5-[(2-hydroxybenzylidene)amino]-2,7-naphthalenedisulfonate (1:1:1) |
| azometine h |
| azomethine-h monosodium salt monohydrate |
| azomethine h, [spectrophotometric reagent for b] |
| azomethine h, pure, for colorimetric determination of boron |