Tetraethyl heptane-1,7-diylbis(phosphonate) structure
|
Common Name | Tetraethyl heptane-1,7-diylbis(phosphonate) | ||
|---|---|---|---|---|
| CAS Number | 5943-17-9 | Molecular Weight | 332.35100 | |
| Density | 1.202g/cm3 | Boiling Point | 494.4ºC at 760mmHg | |
| Molecular Formula | C15H34O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.8ºC | |
Use of Tetraethyl heptane-1,7-diylbis(phosphonate)Tetraethyl heptane-1,7-diylbis(phosphonate) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Methyl 2-{[(2-methoxybenzoyl)(propyl)amino]methyl}-1,3-oxazole-4- carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Tetraethyl heptane-1,7-diylbis(phosphonate) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 494.4ºC at 760mmHg |
| Molecular Formula | C15H34O6P2 |
| Molecular Weight | 332.35100 |
| Flash Point | 252.8ºC |
| Exact Mass | 332.13700 |
| PSA | 81.87000 |
| LogP | 2.52220 |
| Index of Refraction | 1.543 |
| InChIKey | CYRFVVLQCVAMPM-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCCCCCCP(=O)(OCC)OCC)OCC |
|
~%
Tetraethyl hept... CAS#:5943-17-9 |
| Literature: Kosolapoff,G.M.; Brown,A.D. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 757 - 759 |
| MFCD24539458 |