Tetraethyl decane-1,10-diylbis(phosphonate) structure
|
Common Name | Tetraethyl decane-1,10-diylbis(phosphonate) | ||
|---|---|---|---|---|
| CAS Number | 5943-62-4 | Molecular Weight | 414.45400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H40O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tetraethyl decane-1,10-diylbis(phosphonate)Tetraethyl decane-1,10-diylbis(phosphonate) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1,10-bis(diethoxyphosphoryl)decane |
|---|---|
| Synonym | More Synonyms |
| Description | Tetraethyl decane-1,10-diylbis(phosphonate) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C18H40O6P2 |
|---|---|
| Molecular Weight | 414.45400 |
| Exact Mass | 414.23000 |
| PSA | 90.68000 |
| LogP | 6.63940 |
| InChIKey | JSLDHSYSRUFYMI-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCCCCCCCCCP(=O)(OCC)OCC)OCC |
|
~87%
Tetraethyl deca... CAS#:5943-62-4 |
| Literature: Meziane, Dalila; Hardouin, Julie; Elias, Abdelhamid; Guenin, Erwann; Lecouvey, Marc Heteroatom Chemistry, 2009 , vol. 20, # 6 p. 369 - 377 |
|
~%
Tetraethyl deca... CAS#:5943-62-4 |
| Literature: Kosolapoff,G.M.; Brown,A.D. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 757 - 759 |
| 1,10-Bis-(O,O-diethyl-phosphono)-decan |
| Decan-diphosphonsaeure-(1,10)-tetraethylester |
| tetraethyl decane-1,10-diyldiphosphonate |
| TETRAETHYL DECAMETHYLENEDIPHOSPHONATE |
| Decamethylen-bis-(diethylphosphonat) |
| tetra-ethyl decylene diphosphonate |