alpha-Endorphin, 10-de-L-serine-11-de-L-glutamine-12-de-L-threonine-13-de-L-proline-14-de-L-leucine-15-de-L-valine-16-de-L-threonine structure
|
Common Name | alpha-Endorphin, 10-de-L-serine-11-de-L-glutamine-12-de-L-threonine-13-de-L-proline-14-de-L-leucine-15-de-L-valine-16-de-L-threonine | ||
|---|---|---|---|---|
| CAS Number | 59481-79-7 | Molecular Weight | 1019.13000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H66N10O15S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of alpha-Endorphin, 10-de-L-serine-11-de-L-glutamine-12-de-L-threonine-13-de-L-proline-14-de-L-leucine-15-de-L-valine-16-de-L-threonineβ-Lipotropin (61-69) is a potent opioid agonist[1][2]. |
| Name | Tyr-Gly-Gly-Phe-Met-Thr-Ser-Glu-Lys |
|---|
| Description | β-Lipotropin (61-69) is a potent opioid agonist[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | β-Lipotropin (61-69) shows comparable opioid agonist potency with that of enkephalin in guinea-pig ileum[2]. |
| Molecular Formula | C45H66N10O15S |
|---|---|
| Molecular Weight | 1019.13000 |
| Exact Mass | 1018.44000 |
| PSA | 445.43000 |
| LogP | 0.37830 |
| InChIKey | ILNQJIWCDCNMDU-KIHARKTDSA-N |
| SMILES | CSCCC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(C(=O)NC(CO)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O)C(C)O |