3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl-, (1R,5S)
![3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl-, (1R,5S) Structure](https://image.chemsrc.com/caspic/235/595-29-9.png)
3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl-, (1R,5S) structure
|
Common Name | 3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl-, (1R,5S) | ||
|---|---|---|---|---|
| CAS Number | 595-29-9 | Molecular Weight | 182.21600 | |
| Density | 1.137 g/cm3 | Boiling Point | 270ºC at 760 mmHg | |
| Molecular Formula | C10H14O3 | Melting Point | 223ºC | |
| MSDS | N/A | Flash Point | 121.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1r,3s)-(-)-camphoric anhydride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.137 g/cm3 |
|---|---|
| Boiling Point | 270ºC at 760 mmHg |
| Melting Point | 223ºC |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.21600 |
| Flash Point | 121.1ºC |
| Exact Mass | 182.09400 |
| PSA | 43.37000 |
| LogP | 1.51230 |
| Index of Refraction | 1.487 |
| InChIKey | VFZDNKRDYPTSTP-LDWIPMOCSA-N |
| SMILES | CC12CCC(C(=O)OC1=O)C2(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| camphoracidanhydride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of (1r,3s)-(-)-camphoric anhydride? |
| A: Melting point of (1r,3s)-(-)-camphoric anhydride is 223ºC. |
| Q: What is the LogP of (1r,3s)-(-)-camphoric anhydride? |
| A: LogP of (1r,3s)-(-)-camphoric anhydride is 1.51230. |
| Q: What is the SMILES notation of (1r,3s)-(-)-camphoric anhydride? |
| A: SMILES notation of (1r,3s)-(-)-camphoric anhydride is CC12CCC(C(=O)OC1=O)C2(C)C. |
| Q: What is the boiling point of (1r,3s)-(-)-camphoric anhydride? |
| A: Boiling point of (1r,3s)-(-)-camphoric anhydride is 270ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of (1r,3s)-(-)-camphoric anhydride? |
| A: Polar surface area (PSA) of (1r,3s)-(-)-camphoric anhydride is 43.37000. |
| Q: What is the molecular weight of (1r,3s)-(-)-camphoric anhydride? |
| A: Molecular weight of (1r,3s)-(-)-camphoric anhydride is 182.21600. |
| Q: What is the CAS number of (1r,3s)-(-)-camphoric anhydride? |
| A: CAS number of (1r,3s)-(-)-camphoric anhydride is 595-29-9. |
| Q: What is the molecular formula of (1r,3s)-(-)-camphoric anhydride? |
| A: Molecular formula of (1r,3s)-(-)-camphoric anhydride is C10H14O3. |
| Q: What is the English name of (1r,3s)-(-)-camphoric anhydride? |
| A: The English name of (1r,3s)-(-)-camphoric anhydride is (1r,3s)-(-)-camphoric anhydride. |
| Q: What is the safety information for (1r,3s)-(-)-camphoric anhydride? |
| A: Safety information for (1r,3s)-(-)-camphoric anhydride: 26-36/37/39. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |